|
CAS#: 73987-34-5 Product: 3-Chloro-2-(Trichloromethyl)Quinolin-4-Amine No suppilers available for the product. |
| Name | 3-Chloro-2-(Trichloromethyl)Quinolin-4-Amine |
|---|---|
| Synonyms | [3-Chloro-2-(Trichloromethyl)-4-Quinolyl]Amine; 4-Amino-3-Chloro-2-(Trichloromethyl)-Quinoline; 3-Chloro-2-(Trichloromethyl)-4-Quinolinamine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6Cl4N2 |
| Molecular Weight | 295.98 |
| CAS Registry Number | 73987-34-5 |
| SMILES | C1=CC=CC2=NC(=C(C(=C12)N)Cl)C(Cl)(Cl)Cl |
| InChI | 1S/C10H6Cl4N2/c11-7-8(15)5-3-1-2-4-6(5)16-9(7)10(12,13)14/h1-4H,(H2,15,16) |
| InChIKey | KQCLZWSBHCTDLN-UHFFFAOYSA-N |
| Density | 1.623g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.43°C at 760 mmHg (Cal.) |
| Flash point | 200.207°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-2-(Trichloromethyl)Quinolin-4-Amine |