|
CAS#: 74009-52-2 Product: (2R)-Amino(1,3-cyclohexadien-1-yl)acetoyl chloride hydrochloride (1:1) No suppilers available for the product. |
| Name | (2R)-Amino(1,3-cyclohexadien-1-yl)acetoyl chloride hydrochloride (1:1) |
|---|---|
| Synonyms | (R)-α-aminocyclohexadieneacetyl chloride hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H11Cl2NO |
| Molecular Weight | 208.09 |
| CAS Registry Number | 74009-52-2 |
| EINECS | 277-656-1 |
| SMILES | Cl.N[C@@H](C(Cl)=O)C=1CCC=CC=1 |
| InChI | 1S/C8H10ClNO.ClH/c9-8(11)7(10)6-4-2-1-3-5-6;/h1-2,4,7H,3,5,10H2;1H/t7-;/m1./s1 |
| InChIKey | FGBDQRGDHYNPBE-OGFXRTJISA-N |
| Boiling point | 264.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 113.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R)-Amino(1,3-cyclohexadien-1-yl)acetoyl chloride hydrochloride (1:1) |