|
CAS#: 7402-53-1 Product: N-(4-Amino-3,5-Dichloro-Phenyl)Acetamide No suppilers available for the product. |
| Name | N-(4-Amino-3,5-Dichloro-Phenyl)Acetamide |
|---|---|
| Synonyms | N-(4-Amino-3,5-Dichloro-Phenyl)Acetamide; N-(4-Amino-3,5-Dichloro-Phenyl)Ethanamide; Nsc55343 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8Cl2N2O |
| Molecular Weight | 219.07 |
| CAS Registry Number | 7402-53-1 |
| SMILES | C1=C(C=C(Cl)C(=C1Cl)N)NC(=O)C |
| InChI | 1S/C8H8Cl2N2O/c1-4(13)12-5-2-6(9)8(11)7(10)3-5/h2-3H,11H2,1H3,(H,12,13) |
| InChIKey | AWRLPYQRPGYTBM-UHFFFAOYSA-N |
| Density | 1.473g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.307°C at 760 mmHg (Cal.) |
| Flash point | 127.559°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-Amino-3,5-Dichloro-Phenyl)Acetamide |