|
CAS#: 7403-76-1 Product: 4-Diacetylaminophenol No suppilers available for the product. |
| Name | 4-Diacetylaminophenol |
|---|---|
| Synonyms | N-Ethanoyl-N-(4-Hydroxyphenyl)Ethanamide; 4-Diacetylaminophenol; Nsc400391 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 |
| CAS Registry Number | 7403-76-1 |
| SMILES | C1=C(N(C(=O)C)C(=O)C)C=CC(=C1)O |
| InChI | 1S/C10H11NO3/c1-7(12)11(8(2)13)9-3-5-10(14)6-4-9/h3-6,14H,1-2H3 |
| InChIKey | JDSSLYZHFOIWFR-UHFFFAOYSA-N |
| Density | 1.262g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.237°C at 760 mmHg (Cal.) |
| Flash point | 229.724°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Diacetylaminophenol |