|
CAS#: 74038-56-5 Product: 6-Naphthalen-1-Yl-4-Oxohex-5-Enoic Acid No suppilers available for the product. |
| Name | 6-Naphthalen-1-Yl-4-Oxohex-5-Enoic Acid |
|---|---|
| Synonyms | (E)-6-Naphthalen-1-Yl-4-Oxohex-5-Enoic Acid; (E)-6-(1-Naphthyl)-4-Oxo-Hex-5-Enoic Acid; 6-(1-Naphthyl)-4-Oxo-Hex-5-Enoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 |
| CAS Registry Number | 74038-56-5 |
| SMILES | C1=CC=CC2=CC=CC(=C12)\C=C\C(CCC(O)=O)=O |
| InChI | 1S/C16H14O3/c17-14(10-11-16(18)19)9-8-13-6-3-5-12-4-1-2-7-15(12)13/h1-9H,10-11H2,(H,18,19)/b9-8+ |
| InChIKey | ZTNWOJAWCRQTSV-CMDGGOBGSA-N |
| Density | 1.236g/cm3 (Cal.) |
|---|---|
| Boiling point | 498.054°C at 760 mmHg (Cal.) |
| Flash point | 269.11°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Naphthalen-1-Yl-4-Oxohex-5-Enoic Acid |