|
CAS#: 74039-66-0 Product: 8-Butylsulfanyl-1,3-Dimethyl-7H-Purine-2,6-Dione No suppilers available for the product. |
| Name | 8-Butylsulfanyl-1,3-Dimethyl-7H-Purine-2,6-Dione |
|---|---|
| Synonyms | 8-(Butylthio)-1,3-Dimethyl-7H-Purine-2,6-Dione; 8-(Butylthio)-1,3-Dimethyl-7H-Purine-2,6-Quinone; 1H-Purine-2,6-Dione, 8-(Butylthio)-3,7-Dihydro-1,3-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.33 |
| CAS Registry Number | 74039-66-0 |
| SMILES | C(SC2=NC1=C(C(N(C(N1C)=O)C)=O)[NH]2)CCC |
| InChI | 1S/C11H16N4O2S/c1-4-5-6-18-10-12-7-8(13-10)14(2)11(17)15(3)9(7)16/h4-6H2,1-3H3,(H,12,13) |
| InChIKey | WVXHRPNRQMJLPT-UHFFFAOYSA-N |
| Density | 1.373g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.663°C at 760 mmHg (Cal.) |
| Flash point | 242.682°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Butylsulfanyl-1,3-Dimethyl-7H-Purine-2,6-Dione |