|
CAS#: 74051-51-7 Product: 1-(2-Formylphenyl)-3-Prop-2-Enylthiourea No suppilers available for the product. |
| Name | 1-(2-Formylphenyl)-3-Prop-2-Enylthiourea |
|---|---|
| Synonyms | 3-Allyl-1-(2-Formylphenyl)Thiourea; 1-(2-Methanoylphenyl)-3-Prop-2-Enyl-Thiourea; 1-Allyl-3-(2-Formylphenyl)-2-Thiourea |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.29 |
| CAS Registry Number | 74051-51-7 |
| SMILES | C1=C(NC(=S)NCC=C)C(=CC=C1)C=O |
| InChI | 1S/C11H12N2OS/c1-2-7-12-11(15)13-10-6-4-3-5-9(10)8-14/h2-6,8H,1,7H2,(H2,12,13,15) |
| InChIKey | SAONPZIJOUYLKC-UHFFFAOYSA-N |
| Density | 1.231g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.399°C at 760 mmHg (Cal.) |
| Flash point | 159.668°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Formylphenyl)-3-Prop-2-Enylthiourea |