|
CAS#: 7408-66-4 Product: 2-Chloro-6-Isopropyl-m-Cresol No suppilers available for the product. |
| Name | 2-Chloro-6-Isopropyl-m-Cresol |
|---|---|
| Synonyms | 2-Chloro-6-Isopropyl-3-Methyl-Phenol; 2-Chloro-6-Isopropyl-3-Methylphenol; 2-Chloro-3-Methyl-6-Propan-2-Yl-Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13ClO |
| Molecular Weight | 184.67 |
| CAS Registry Number | 7408-66-4 |
| EINECS | 231-016-8 |
| SMILES | C1=C(C(=C(C(=C1)C)Cl)O)C(C)C |
| InChI | 1S/C10H13ClO/c1-6(2)8-5-4-7(3)9(11)10(8)12/h4-6,12H,1-3H3 |
| InChIKey | ZBELFWZTAZVRLL-UHFFFAOYSA-N |
| Density | 1.111g/cm3 (Cal.) |
|---|---|
| Boiling point | 238.821°C at 760 mmHg (Cal.) |
| Flash point | 98.236°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-6-Isopropyl-m-Cresol |