|
CAS#: 74161-27-6 Product: 6-Methoxy-2-Methyl-1-Benzofuran-4,7-Dione No suppilers available for the product. |
| Name | 6-Methoxy-2-Methyl-1-Benzofuran-4,7-Dione |
|---|---|
| Synonyms | 6-Methoxy-2-Methyl-Benzofuran-4,7-Dione; 6-Methoxy-2-Methylbenzofuran-4,7-Dione; 6-Methoxy-2-Methyl-Benzofuran-4,7-Quinone |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.17 |
| CAS Registry Number | 74161-27-6 |
| SMILES | C1=C(OC2=C1C(=O)C=C(OC)C2=O)C |
| InChI | 1S/C10H8O4/c1-5-3-6-7(11)4-8(13-2)9(12)10(6)14-5/h3-4H,1-2H3 |
| InChIKey | DNQLVCZXYPFUHF-UHFFFAOYSA-N |
| Density | 1.326g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.712°C at 760 mmHg (Cal.) |
| Flash point | 171.952°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methoxy-2-Methyl-1-Benzofuran-4,7-Dione |