Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 3-Methyl-1,2-Pentadiene |
|---|---|
| Synonyms | 1,2-Pentadiene,3-Methyl; 1,2-Pentadiene, 3-Methyl-; Inchi=1/C6h10/C1-4-6(3)5-2/H1,5H2,2-3H |
| Molecular Structure |  |
| Molecular Formula | C6H10 |
| Molecular Weight | 82.15 |
| CAS Registry Number | 7417-48-3 |
| EINECS | 231-033-0 |
| SMILES | C([C](=[C]=[CH2])C)C |
| InChI | 1S/C6H10/c1-4-6(3)5-2/h1,5H2,2-3H3 |
| InChIKey | INFFCVIZNSUFGK-UHFFFAOYSA-N |
| Density | 0.678g/cm3 (Cal.) |
|---|---|
| Boiling point | 69.999°C at 760 mmHg (Cal.) |
| Flash point | -17.325°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-1,2-Pentadiene |