|
CAS#: 74237-20-0 Product: 6-Chloro-1,4-Dihydroxynaphthalene-2,3-Dione No suppilers available for the product. |
| Name | 6-Chloro-1,4-Dihydroxynaphthalene-2,3-Dione |
|---|---|
| Synonyms | 6-Chloro-1,4-Dihydroxy-Naphthalene-2,3-Dione; 6-Chloro-1,4-Dihydroxy-2,3-Naphthoquinone; 1,4-Naphthalenedione, 6-Chloro-2,3-Dihydroxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H5ClO4 |
| Molecular Weight | 224.60 |
| CAS Registry Number | 74237-20-0 |
| SMILES | O=C1C(=C2C(=C(O)C1=O)C=CC(=C2)Cl)O |
| InChI | 1S/C10H5ClO4/c11-4-1-2-5-6(3-4)8(13)10(15)9(14)7(5)12/h1-3,12-13H |
| InChIKey | NRTNVJSQLIUQHN-UHFFFAOYSA-N |
| Density | 1.729g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.916°C at 760 mmHg (Cal.) |
| Flash point | 179.333°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-1,4-Dihydroxynaphthalene-2,3-Dione |