|
CAS#: 742690-32-0 Product: Methyl 2,4-dimethyl-3-quinolinecarboxylate No suppilers available for the product. |
| Name | Methyl 2,4-dimethyl-3-quinolinecarboxylate |
|---|---|
| Synonyms | methyl 2,4-dimethylquinoline-3-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 |
| CAS Registry Number | 742690-32-0 |
| SMILES | O=C(OC)c1c(c2ccccc2nc1C)C |
| InChI | 1S/C13H13NO2/c1-8-10-6-4-5-7-11(10)14-9(2)12(8)13(15)16-3/h4-7H,1-3H3 |
| InChIKey | XQLNMJAKGKSIJR-UHFFFAOYSA-N |
| Density | 1.15g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.722°C at 760 mmHg (Cal.) |
| Flash point | 138.696°C (Cal.) |
| Refractive index | 1.595 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2,4-dimethyl-3-quinolinecarboxylate |