|
CAS#: 74271-42-4 Product: 3-Methyl-5-(Phenylmethyl)Pyridine No suppilers available for the product. |
| Name | 3-Methyl-5-(Phenylmethyl)Pyridine |
|---|---|
| Synonyms | 3-(Benzyl)-5-Methyl-Pyridine; 5-Benzyl-3-Methylpyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 |
| CAS Registry Number | 74271-42-4 |
| EINECS | 277-797-9 |
| SMILES | C2=C(CC1=CC=CC=C1)C=C(C=N2)C |
| InChI | 1S/C13H13N/c1-11-7-13(10-14-9-11)8-12-5-3-2-4-6-12/h2-7,9-10H,8H2,1H3 |
| InChIKey | UCWQMPICSBZRLS-UHFFFAOYSA-N |
| Density | 1.028g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.652°C at 760 mmHg (Cal.) |
| Flash point | 128.229°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-5-(Phenylmethyl)Pyridine |