|
CAS#: 743-51-1 Product: Byssochlamic Acid No suppilers available for the product. |
| Name | Byssochlamic Acid |
|---|---|
| Synonyms | Spectrum3_001705; Kbio3_002510; Spectrum4_001852 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 |
| CAS Registry Number | 743-51-1 |
| SMILES | [C@H]2(C1=C(C(OC1=O)=O)C[C@@H](CC3=C(C2)C(OC3=O)=O)CC)CCC |
| InChI | 1S/C18H20O6/c1-3-5-10-8-12-11(15(19)23-16(12)20)6-9(4-2)7-13-14(10)18(22)24-17(13)21/h9-10H,3-8H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | NRDWUPPIGBHWAS-ZJUUUORDSA-N |
| Density | 1.299g/cm3 (Cal.) |
|---|---|
| Boiling point | 536.279°C at 760 mmHg (Cal.) |
| Flash point | 237.712°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Byssochlamic Acid |