| Enamine Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Name | 5-(3-Indolylmethyl)-3-N-Methylhydantoin |
|---|---|
| Synonyms | 5-(1H-Indol-3-Ylmethyl)-3-Methyl-Imidazolidine-2,4-Dione; 5-(1H-Indol-3-Ylmethyl)-3-Methyl-Hydantoin; 5-(3-Indolylmethyl)-3-N-Methylhydantoin |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.26 |
| CAS Registry Number | 74311-00-5 |
| SMILES | C1=C(C2=C([NH]1)C=CC=C2)CC3NC(=O)N(C3=O)C |
| InChI | 1S/C13H13N3O2/c1-16-12(17)11(15-13(16)18)6-8-7-14-10-5-3-2-4-9(8)10/h2-5,7,11,14H,6H2,1H3,(H,15,18) |
| InChIKey | PANAMPMZPUJRLL-UHFFFAOYSA-N |
| Density | 1.355g/cm3 (Cal.) |
|---|---|
| (1) | Degterev et al.. Identification of RIP1 kinase as a specific cellular target of necrostatins, Nature Chemical Biology, 2008 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-(3-Indolylmethyl)-3-N-Methylhydantoin |