|
CAS#: 74332-87-9 Product: 1-(1-Phenylpentyl)Pyrrolidine Hydrochloride No suppilers available for the product. |
| Name | 1-(1-Phenylpentyl)Pyrrolidine Hydrochloride |
|---|---|
| Synonyms | H 466; Pyrrolidine, 1-(1-Phenylpentyl)-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24ClN |
| Molecular Weight | 253.81 |
| CAS Registry Number | 74332-87-9 |
| SMILES | [H+].C2=C(C(N1CCCC1)CCCC)C=CC=C2.[Cl-] |
| InChI | 1S/C15H23N.ClH/c1-2-3-11-15(16-12-7-8-13-16)14-9-5-4-6-10-14;/h4-6,9-10,15H,2-3,7-8,11-13H2,1H3;1H |
| InChIKey | BYUKWISULSTRFI-UHFFFAOYSA-N |
| Boiling point | 288.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 117.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1-Phenylpentyl)Pyrrolidine Hydrochloride |