|
CAS#: 743430-51-5 Product: 2-Methyl-2-propanyl [(E)-2-thienylmethylene]carbamate No suppilers available for the product. |
| Name | 2-Methyl-2-propanyl [(E)-2-thienylmethylene]carbamate |
|---|---|
| Synonyms | (E)-tert-butyl (thiophen-2-ylmethylene)carbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.28 |
| CAS Registry Number | 743430-51-5 |
| SMILES | O=C(OC(C)(C)C)\N=C\c1sccc1 |
| InChI | 1S/C10H13NO2S/c1-10(2,3)13-9(12)11-7-8-5-4-6-14-8/h4-7H,1-3H3/b11-7+ |
| InChIKey | OPEGTHBKWZQMQJ-YRNVUSSQSA-N |
| Density | 1.107g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.29°C at 760 mmHg (Cal.) |
| Flash point | 129.363°C (Cal.) |
| Refractive index | 1.532 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl [(E)-2-thienylmethylene]carbamate |