|
CAS#: 74401-28-8 Product: N-Methyl-9,10-Ethanoanthracene-9(10H)-Methylamine No suppilers available for the product. |
| Name | N-Methyl-9,10-Ethanoanthracene-9(10H)-Methylamine |
|---|---|
| Synonyms | Benzoctamine; Brn 2811058; Benzoctamina [Inn-Spanish] |
| Molecular Structure | ![]() |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.35 |
| CAS Registry Number | 74401-28-8 |
| EINECS | 277-849-0 |
| SMILES | C1=CC=C2C(=C1)C3C4=C(C2(CNC)CC3)C=CC=C4 |
| InChI | 1S/C18H19N/c1-19-12-18-11-10-13(14-6-2-4-8-16(14)18)15-7-3-5-9-17(15)18/h2-9,13,19H,10-12H2,1H3 |
| InChIKey | GNRXCIONJWKSEA-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.0±11.0°C at 760 mmHg (Cal.) |
| Flash point | 181.1±11.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Methyl-9,10-Ethanoanthracene-9(10H)-Methylamine |