|
CAS#: 74422-23-4 Product: 1alpha-Demethylmitomycin G No suppilers available for the product. |
| Name | 1alpha-Demethylmitomycin G |
|---|---|
| Synonyms | Azirino(2',3':3,4)Pyrrolo(1,2-A)Indole-4,7-Dione, 1,1A,2,8,8A,8B-Hexahydro-6-Amino-8A-Methoxy-5-Methyl-8-Methylene-, (1As-(1A-Alpha,8A-Alpha,8B-Alpha))-; Azirino(2',3':3,4)Pyrrolo(1,2-A)Indole-4,7-Dione, 6-Amino-1,1A,2,8,8A,8B-Hexahydro-8A-Methoxy-5-Methyl-8-Methylene-, (1As-(1Aalpha,8Aalpha,8Balpha))- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 |
| CAS Registry Number | 74422-23-4 |
| SMILES | [C@@H]12N[C@@H]1CN3[C@@]2(OC)C(C4=C3C(=O)C(=C(N)C4=O)C)=C |
| InChI | 1S/C14H15N3O3/c1-5-9(15)12(19)8-6(2)14(20-3)13-7(16-13)4-17(14)10(8)11(5)18/h7,13,16H,2,4,15H2,1,3H3/t7-,13-,14-/m1/s1 |
| InChIKey | NZNFISCGOZNYBD-HGDANNRKSA-N |
| Density | 1.474g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.432°C at 760 mmHg (Cal.) |
| Flash point | 232.866°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1alpha-Demethylmitomycin G |