|
CAS#: 74443-99-5 Product: N-(2-Diethylaminoethyl)Prop-2-Enamide Hydrochloride No suppilers available for the product. |
| Name | N-(2-Diethylaminoethyl)Prop-2-Enamide Hydrochloride |
|---|---|
| Synonyms | N-(2-Diethylaminoethyl)Acrylamide Hydrochloride; N-(2-(Diethylamino)Ethyl)Acrylamide Monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C9H19ClN2O |
| Molecular Weight | 206.71 |
| CAS Registry Number | 74443-99-5 |
| EINECS | 277-875-2 |
| SMILES | [H+].C(N(CC)CC)CNC(=O)C=C.[Cl-] |
| InChI | 1S/C9H18N2O.ClH/c1-4-9(12)10-7-8-11(5-2)6-3;/h4H,1,5-8H2,2-3H3,(H,10,12);1H |
| InChIKey | IEWKGYJNURLXHT-UHFFFAOYSA-N |
| Boiling point | 298.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 134.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Diethylaminoethyl)Prop-2-Enamide Hydrochloride |