|
CAS#: 74499-19-7 Product: Potassium 4-(4-Chloro-2-Methylphenoxy)Butanoate No suppilers available for the product. |
| Name | Potassium 4-(4-Chloro-2-Methylphenoxy)Butanoate |
|---|---|
| Synonyms | Potassium 4-(4-Chloro-2-Methyl-Phenoxy)Butanoate; Potassium 4-(4-Chloro-2-Methyl-Phenoxy)Butyrate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12ClKO3 |
| Molecular Weight | 266.77 |
| CAS Registry Number | 74499-19-7 |
| EINECS | 277-892-5 |
| SMILES | C1=C(Cl)C=CC(=C1C)OCCCC([O-])=O.[K+] |
| InChI | 1S/C11H13ClO3.K/c1-8-7-9(12)4-5-10(8)15-6-2-3-11(13)14;/h4-5,7H,2-3,6H2,1H3,(H,13,14);/q;+1/p-1 |
| InChIKey | YBCBPGLPJRYHPG-UHFFFAOYSA-M |
| Boiling point | 393.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 191.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium 4-(4-Chloro-2-Methylphenoxy)Butanoate |