|
CAS#: 745-10-8 Product: Glauconic Acid No suppilers available for the product. |
| Name | Glauconic Acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C18H20O7 |
| Molecular Weight | 348.35 |
| CAS Registry Number | 745-10-8 |
| SMILES | C(C1C(O)C3=C(CC2(C(=C\C1CC)/C(OC2=O)=O)C)C(OC3=O)=O)C |
| InChI | 1S/C18H20O7/c1-4-8-6-11-15(21)25-17(23)18(11,3)7-10-12(13(19)9(8)5-2)16(22)24-14(10)20/h6,8-9,13,19H,4-5,7H2,1-3H3/b11-6- |
| InChIKey | VERYNZFRBNJXKD-WDZFZDKYSA-N |
| Density | 1.369g/cm3 (Cal.) |
|---|---|
| Boiling point | 584.552°C at 760 mmHg (Cal.) |
| Flash point | 213.043°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Glauconic Acid |