|
CAS#: 7452-29-1 Product: Sodium O,O-diethyl phosphoroselenoate No suppilers available for the product. |
| Name | Sodium O,O-diethyl phosphoroselenoate |
|---|---|
| Synonyms | Phosphoroselenoic acid, O,O-diethyl ester, sodium salt; Sodium ethylphosphoroselenoate |
| Molecular Structure | ![]() |
| Molecular Formula | C4H10NaO3PSe |
| Molecular Weight | 239.04 |
| CAS Registry Number | 7452-29-1 |
| SMILES | [Na+].[O-]P(=[Se])(OCC)OCC |
| InChI | 1S/C4H11O3PSe.Na/c1-3-6-8(5,9)7-4-2;/h3-4H2,1-2H3,(H,5,9);/q;+1/p-1 |
| InChIKey | XYJPXGFHBSTPMZ-UHFFFAOYSA-M |
| Boiling point | 239.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 98.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium O,O-diethyl phosphoroselenoate |