|
CAS#: 74550-87-1 Product: 2-Cyclopropyl-1-Methyl-5-Nitroimidazole No suppilers available for the product. |
| Name | 2-Cyclopropyl-1-Methyl-5-Nitroimidazole |
|---|---|
| Synonyms | 2-Cyclopropyl-1-Methyl-5-Nitro-Imidazole; 2-Cyclopropyl-1-Methyl-5-Nitro-1H-Imidazole; Da 3851 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 |
| CAS Registry Number | 74550-87-1 |
| SMILES | C1=C([N](C)C(=N1)C2CC2)[N+]([O-])=O |
| InChI | 1S/C7H9N3O2/c1-9-6(10(11)12)4-8-7(9)5-2-3-5/h4-5H,2-3H2,1H3 |
| InChIKey | DQOYEOYSZVBYQN-UHFFFAOYSA-N |
| Density | 1.546g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.227°C at 760 mmHg (Cal.) |
| Flash point | 175.288°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Cyclopropyl-1-Methyl-5-Nitroimidazole |