|
CAS#: 74592-61-3 Product: N,N-Dimethylmethanaminium (4-chloro-2-methylphenoxy)acetate No suppilers available for the product. |
| Name | N,N-Dimethylmethanaminium (4-chloro-2-methylphenoxy)acetate |
|---|---|
| Synonyms | trimethylammonium 4-chloro-o-tolyloxyacetate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18ClNO3 |
| Molecular Weight | 259.73 |
| CAS Registry Number | 74592-61-3 |
| EINECS | 277-934-2 |
| SMILES | Clc1cc(C)c(OCC([O-])=O)cc1.C[NH+](C)C |
| InChI | 1S/C9H9ClO3.C3H9N/c1-6-4-7(10)2-3-8(6)13-5-9(11)12;1-4(2)3/h2-4H,5H2,1H3,(H,11,12);1-3H3 |
| InChIKey | FFYSVPAWEKVDHM-UHFFFAOYSA-N |
| Boiling point | 361.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 172.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethylmethanaminium (4-chloro-2-methylphenoxy)acetate |