|
CAS#: 74602-56-5 Product: 2-Amino-5-Bromo-6-(2-Fluorophenyl)-1H-Pyrimidin-4-One No suppilers available for the product. |
| Name | 2-Amino-5-Bromo-6-(2-Fluorophenyl)-1H-Pyrimidin-4-One |
|---|---|
| Synonyms | 2-Amino-5-Bromo-6-(2-Fluorophenyl)-4(3H)-Pyrimidinone; Aids-186350; Aids186350 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H7BrFN3O |
| Molecular Weight | 284.09 |
| CAS Registry Number | 74602-56-5 |
| SMILES | C2=C(C1=C(Br)C(=O)N=C(N1)N)C(=CC=C2)F |
| InChI | 1S/C10H7BrFN3O/c11-7-8(14-10(13)15-9(7)16)5-3-1-2-4-6(5)12/h1-4H,(H3,13,14,15,16) |
| InChIKey | UHKUZWMIMIJLAZ-UHFFFAOYSA-N |
| Density | 1.826g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.351°C at 760 mmHg (Cal.) |
| Flash point | 190.483°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-5-Bromo-6-(2-Fluorophenyl)-1H-Pyrimidin-4-One |