|
CAS#: 74630-27-6 Product: Phenyl(1,7,7-trimethylbicyclo[2.2.1]hept-2-yl)phosphinous chloride No suppilers available for the product. |
| Name | Phenyl(1,7,7-trimethylbicyclo[2.2.1]hept-2-yl)phosphinous chloride |
|---|---|
| Synonyms | Phenyl(1, |
| Molecular Structure | ![]() |
| Molecular Formula | C16H22ClP |
| Molecular Weight | 280.77 |
| CAS Registry Number | 74630-27-6 |
| SMILES | ClP(c1ccccc1)C3CC2CCC3(C2(C)C)C |
| InChI | 1S/C16H22ClP/c1-15(2)12-9-10-16(15,3)14(11-12)18(17)13-7-5-4-6-8-13/h4-8,12,14H,9-11H2,1-3H3 |
| InChIKey | ZZXUWGKZBSNIPA-UHFFFAOYSA-N |
| Boiling point | 324.912°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 150.302°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl(1,7,7-trimethylbicyclo[2.2.1]hept-2-yl)phosphinous chloride |