|
CAS#: 7464-22-4 Product: 1H-Benzimidazole, 2-(1-Propenyl)- No suppilers available for the product. |
| Name | 1H-Benzimidazole, 2-(1-Propenyl)- |
|---|---|
| Synonyms | 2-[(E)-Prop-1-Enyl]-1H-Benzimidazole; Nsc403382 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 |
| CAS Registry Number | 7464-22-4 |
| SMILES | C1=CC=CC2=C1[NH]C(=N2)\C=C\C |
| InChI | 1S/C10H10N2/c1-2-5-10-11-8-6-3-4-7-9(8)12-10/h2-7H,1H3,(H,11,12)/b5-2+ |
| InChIKey | LGWRNIXKHGASPF-GORDUTHDSA-N |
| Density | 1.163g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.284°C at 760 mmHg (Cal.) |
| Flash point | 171.837°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1H-Benzimidazole, 2-(1-Propenyl)- |