|
CAS#: 7466-42-4 Product: 4-Phenylazobenzene No suppilers available for the product. |
| Name | 4-Phenylazobenzene |
|---|---|
| Synonyms | 4-Phenylazobenzene; 4-(Phenylazo)Biphenyl; 4-Phenylazodiphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C18H14N2 |
| Molecular Weight | 258.32 |
| CAS Registry Number | 7466-42-4 |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)N=NC3=CC=CC=C3 |
| InChI | 1S/C18H14N2/c1-3-7-15(8-4-1)16-11-13-18(14-12-16)20-19-17-9-5-2-6-10-17/h1-14H |
| InChIKey | SPKVCOASFOEAMJ-UHFFFAOYSA-N |
| Density | 1.049g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.075°C at 760 mmHg (Cal.) |
| Flash point | 201.052°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Phenylazobenzene |