|
CAS#: 7467-90-5 Product: 3,3'',4,4'',5,5''-Hexamethoxybenzoin No suppilers available for the product. |
| Name | 3,3'',4,4'',5,5''-Hexamethoxybenzoin |
|---|---|
| Synonyms | Nsc400598 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H24O8 |
| Molecular Weight | 392.40 |
| CAS Registry Number | 7467-90-5 |
| SMILES | C2=C(C(C(C1=CC(=C(OC)C(=C1)OC)OC)O)=O)C=C(OC)C(=C2OC)OC |
| InChI | 1S/C20H24O8/c1-23-13-7-11(8-14(24-2)19(13)27-5)17(21)18(22)12-9-15(25-3)20(28-6)16(10-12)26-4/h7-10,17,21H,1-6H3 |
| InChIKey | JIDNYUKRPUJZAL-UHFFFAOYSA-N |
| Density | 1.211g/cm3 (Cal.) |
|---|---|
| Boiling point | 535.588°C at 760 mmHg (Cal.) |
| Flash point | 184.241°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3'',4,4'',5,5''-Hexamethoxybenzoin |