|
CAS#: 74685-37-3 Product: 2-Isopropyl-5-methylcyclohexyl isopropyl(4-methoxyphenyl)phosphinite No suppilers available for the product. |
| Name | 2-Isopropyl-5-methylcyclohexyl isopropyl(4-methoxyphenyl)phosphinite |
|---|---|
| Synonyms | 2-Isoprop |
| Molecular Structure | ![]() |
| Molecular Formula | C20H33O2P |
| Molecular Weight | 336.45 |
| CAS Registry Number | 74685-37-3 |
| SMILES | O(P(c1ccc(OC)cc1)C(C)C)C2CC(CCC2C(C)C)C |
| InChI | 1S/C20H33O2P/c1-14(2)19-12-7-16(5)13-20(19)22-23(15(3)4)18-10-8-17(21-6)9-11-18/h8-11,14-16,19-20H,7,12-13H2,1-6H3 |
| InChIKey | GDQUVURAWKJSPC-UHFFFAOYSA-N |
| Boiling point | 406.676°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 247.261°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Isopropyl-5-methylcyclohexyl isopropyl(4-methoxyphenyl)phosphinite |