|
CAS#: 7469-01-4 Product: omega-Chloro-beta,omega-Diphenylpropiophenone No suppilers available for the product. |
| Name | omega-Chloro-beta,omega-Diphenylpropiophenone |
|---|---|
| Synonyms | Nsc401205; 3-Chloro-1,2,3-Triphenyl-1-Propanone; 3-Chloro-2,3-Diphenylpropiophenone |
| Molecular Structure | ![]() |
| Molecular Formula | C21H17ClO |
| Molecular Weight | 320.82 |
| CAS Registry Number | 7469-01-4 |
| SMILES | C1=CC=CC=C1C(C(C2=CC=CC=C2)=O)C(C3=CC=CC=C3)Cl |
| InChI | 1S/C21H17ClO/c22-20(17-12-6-2-7-13-17)19(16-10-4-1-5-11-16)21(23)18-14-8-3-9-15-18/h1-15,19-20H |
| InChIKey | HYMIKXVDTULUIP-UHFFFAOYSA-N |
| Density | 1.181g/cm3 (Cal.) |
|---|---|
| Boiling point | 459.527°C at 760 mmHg (Cal.) |
| Flash point | 281.972°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for omega-Chloro-beta,omega-Diphenylpropiophenone |