|
CAS#: 7470-56-6 Product: N-Acetyl-N-(3-Methoxyphenanthren-9-Yl)Acetamide No suppilers available for the product. |
| Name | N-Acetyl-N-(3-Methoxyphenanthren-9-Yl)Acetamide |
|---|---|
| Synonyms | N-Acetyl-N-(3-Methoxy-9-Phenanthryl)Acetamide; N-Ethanoyl-N-(3-Methoxyphenanthren-9-Yl)Ethanamide; Nsc402403 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 |
| CAS Registry Number | 7470-56-6 |
| SMILES | C1=CC2=C(C=C1OC)C3=C(C(=C2)N(C(C)=O)C(C)=O)C=CC=C3 |
| InChI | 1S/C19H17NO3/c1-12(21)20(13(2)22)19-10-14-8-9-15(23-3)11-18(14)16-6-4-5-7-17(16)19/h4-11H,1-3H3 |
| InChIKey | XETUYHYLAKJDLO-UHFFFAOYSA-N |
| Density | 1.245g/cm3 (Cal.) |
|---|---|
| Boiling point | 573.845°C at 760 mmHg (Cal.) |
| Flash point | 300.851°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Acetyl-N-(3-Methoxyphenanthren-9-Yl)Acetamide |