|
CAS#: 7475-11-8 Product: 1,4,6-Trihydroxyanthraquinone No suppilers available for the product. |
| Name | 1,4,6-Trihydroxyanthraquinone |
|---|---|
| Synonyms | 1,4,6-Trihydroxy-9,10-Anthraquinone; 1,4,6-Trihydroxyanthraquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8O5 |
| Molecular Weight | 256.21 |
| CAS Registry Number | 7475-11-8 |
| EINECS | 231-276-2 |
| SMILES | C1=C(O)C=CC3=C1C(=O)C2=C(O)C=CC(=C2C3=O)O |
| InChI | 1S/C14H8O5/c15-6-1-2-7-8(5-6)14(19)12-10(17)4-3-9(16)11(12)13(7)18/h1-5,15-17H |
| InChIKey | FDXKFCSGFMVEEG-UHFFFAOYSA-N |
| Density | 1.66g/cm3 (Cal.) |
|---|---|
| Boiling point | 497.813°C at 760 mmHg (Cal.) |
| Flash point | 268.964°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4,6-Trihydroxyanthraquinone |