|
CAS#: 7476-79-1 Product: 4-Nitrosobenzoic Acid Ethyl Ester No suppilers available for the product. |
| Name | 4-Nitrosobenzoic Acid Ethyl Ester |
|---|---|
| Synonyms | 4-Nitrosobenzoic Acid Ethyl Ester; Ethyl P-Nitrosobenzoate; Nsc402965 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.18 |
| CAS Registry Number | 7476-79-1 |
| SMILES | C1=C(C=CC(=C1)C(=O)OCC)N=O |
| InChI | 1S/C9H9NO3/c1-2-13-9(11)7-3-5-8(10-12)6-4-7/h3-6H,2H2,1H3 |
| InChIKey | QKVJSTCHTZXKHI-UHFFFAOYSA-N |
| Density | 1.165g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.404°C at 760 mmHg (Cal.) |
| Flash point | 137.502°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitrosobenzoic Acid Ethyl Ester |