|
CAS#: 74792-98-6 Product: 1,2,4,5-Tetramethyl-6-methylenespiro[2.4]heptane No suppilers available for the product. |
| Name | 1,2,4,5-Tetramethyl-6-methylenespiro[2.4]heptane |
|---|---|
| Synonyms | 1,2,4,5-Tetramethyl-6-methylenespiro[2.4]heptane # |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 |
| CAS Registry Number | 74792-98-6 |
| SMILES | C2(=C)\CC1(C(C1C)C)C(C)C2C |
| InChI | 1S/C12H20/c1-7-6-12(9(3)8(7)2)10(4)11(12)5/h8-11H,1,6H2,2-5H3 |
| InChIKey | JAUOXJQLPADTPK-UHFFFAOYSA-N |
| Density | 0.877g/cm3 (Cal.) |
|---|---|
| Boiling point | 199.668°C at 760 mmHg (Cal.) |
| Flash point | 64.456°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,4,5-Tetramethyl-6-methylenespiro[2.4]heptane |