|
CAS#: 74810-82-5 Product: N-(3-Chloropropyl)-N-methylbenzenesulfonamide No suppilers available for the product. |
| Name | N-(3-Chloropropyl)-N-methylbenzenesulfonamide |
|---|---|
| Synonyms | N-(3-Chloropropyl)-N-methylbenzenesulfonamide # |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14ClNO2S |
| Molecular Weight | 247.74 |
| CAS Registry Number | 74810-82-5 |
| SMILES | O=S(=O)(N(CCCCl)C)c1ccccc1 |
| InChI | 1S/C10H14ClNO2S/c1-12(9-5-8-11)15(13,14)10-6-3-2-4-7-10/h2-4,6-7H,5,8-9H2,1H3 |
| InChIKey | RWZCQCOKSKUHKY-UHFFFAOYSA-N |
| Density | 1.243g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.86°C at 760 mmHg (Cal.) |
| Flash point | 173.857°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3-Chloropropyl)-N-methylbenzenesulfonamide |