|
CAS#: 74912-73-5 Product: 1,3,5-Tribromo-2-(2-Methylprop-2-Enoxy)Benzene No suppilers available for the product. |
| Name | 1,3,5-Tribromo-2-(2-Methylprop-2-Enoxy)Benzene |
|---|---|
| Synonyms | 1,3,5-Tribromo-2-((2-Methylallyl)Oxy)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9Br3O |
| Molecular Weight | 384.89 |
| CAS Registry Number | 74912-73-5 |
| EINECS | 278-021-1 |
| SMILES | C1=C(Br)C(=C(Br)C=C1Br)OCC(=C)C |
| InChI | 1S/C10H9Br3O/c1-6(2)5-14-10-8(12)3-7(11)4-9(10)13/h3-4H,1,5H2,2H3 |
| InChIKey | FEQUNVGZLNZWBK-UHFFFAOYSA-N |
| Density | 1.865g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.994°C at 760 mmHg (Cal.) |
| Flash point | 143.986°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Tribromo-2-(2-Methylprop-2-Enoxy)Benzene |