|
CAS#: 7492-69-5 Product: 2,3-Dimethyl-2-Butenoic Acid Phenylmethyl Ester No suppilers available for the product. |
| Name | 2,3-Dimethyl-2-Butenoic Acid Phenylmethyl Ester |
|---|---|
| Synonyms | 2,3-Dimethylbut-2-Enoic Acid Phenylmethyl Ester; 2,3-Dimethylbut-2-Enoic Acid Benzyl Ester; 2-Butenoic Acid, 2,3-Dimethyl-, Phenylmethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 |
| CAS Registry Number | 7492-69-5 |
| FEMA | 2143 |
| SMILES | C1=C(COC(=O)C(=C(C)C)C)C=CC=C1 |
| InChI | 1S/C13H16O2/c1-10(2)11(3)13(14)15-9-12-7-5-4-6-8-12/h4-8H,9H2,1-3H3 |
| InChIKey | LHDWSNQMWAZQPX-UHFFFAOYSA-N |
| Density | 1.014g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.348°C at 760 mmHg (Cal.) |
| Flash point | 146.967°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dimethyl-2-Butenoic Acid Phenylmethyl Ester |