|
CAS#: 7495-76-3 Product: Sodium 2-Ethylhexyldithiocarbamate No suppilers available for the product. |
| Name | Sodium 2-Ethylhexyldithiocarbamate |
|---|---|
| Synonyms | Sodium 2-Ethylhexyldithiocarbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H18NNaS2 |
| Molecular Weight | 227.36 |
| CAS Registry Number | 7495-76-3 |
| EINECS | 231-345-7 |
| SMILES | C(NC([S-])=S)C(CCCC)CC.[Na+] |
| InChI | 1S/C9H19NS2.Na/c1-3-5-6-8(4-2)7-10-9(11)12;/h8H,3-7H2,1-2H3,(H2,10,11,12);/q;+1/p-1 |
| InChIKey | DANVAOQFLDKILA-UHFFFAOYSA-M |
| Boiling point | 262.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 112.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 2-Ethylhexyldithiocarbamate |