|
CAS#: 74976-69-5 Product: L-Prolyl-5-oxo-L-proline No suppilers available for the product. |
| Name | L-Prolyl-5-oxo-L-proline |
|---|---|
| Synonyms | 5-oxo-1-L-prolyl-L-proline |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 |
| CAS Registry Number | 74976-69-5 |
| EINECS | 278-042-6 |
| SMILES | O=C(N1C(=O)CC[C@H]1C(O)=O)[C@@H]2CCCN2 |
| InChI | 1S/C10H14N2O4/c13-8-4-3-7(10(15)16)12(8)9(14)6-2-1-5-11-6/h6-7,11H,1-5H2,(H,15,16)/t6-,7-/m0/s1 |
| InChIKey | RSZZIJPHQIDLTR-BQBZGAKWSA-N |
| Density | 1.409g/cm3 (Cal.) |
|---|---|
| Boiling point | 478.005°C at 760 mmHg (Cal.) |
| Flash point | 242.889°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-Prolyl-5-oxo-L-proline |