|
CAS#: 74997-72-1 Product: Sodium 4-(2-Ethylhexoxycarbonyl)Phenolate No suppilers available for the product. |
| Name | Sodium 4-(2-Ethylhexoxycarbonyl)Phenolate |
|---|---|
| Synonyms | Sodium 4-(2-Ethylhexoxy-Oxomethyl)Phenolate; Sodium 2-Ethylhexyl 4-Oxidobenzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H21NaO3 |
| Molecular Weight | 272.32 |
| CAS Registry Number | 74997-72-1 |
| EINECS | 278-048-9 |
| SMILES | C1=C(C(OCC(CCCC)CC)=O)C=CC(=C1)[O-].[Na+] |
| InChI | 1S/C15H22O3.Na/c1-3-5-6-12(4-2)11-18-15(17)13-7-9-14(16)10-8-13;/h7-10,12,16H,3-6,11H2,1-2H3;/q;+1/p-1 |
| InChIKey | ISCKUIBTVLMXRZ-UHFFFAOYSA-M |
| Boiling point | 362.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 144.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 4-(2-Ethylhexoxycarbonyl)Phenolate |