|
CAS#: 7500-79-0 Product: N-(Diphenylmethylene)Methanamine N-Oxide No suppilers available for the product. |
| Name | N-(Diphenylmethylene)Methanamine N-Oxide |
|---|---|
| Synonyms | Nitrone, N-Methyl-.Alpha.,.Alpha.-Diphenyl-; Methanamine, N-(Diphenylmethylene)-, N-Oxide; Nsc408018 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 |
| CAS Registry Number | 7500-79-0 |
| SMILES | C1=CC=C(C=C1)C(=[N+]([O-])C)C2=CC=CC=C2 |
| InChI | 1S/C14H13NO/c1-15(16)14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey | LXPUDLOXVOGRMH-UHFFFAOYSA-N |
| Density | 1.079g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.897°C at 760 mmHg (Cal.) |
| Flash point | 165.653°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(Diphenylmethylene)Methanamine N-Oxide |