|
CAS#: 7504-51-0 Product: 2-Butyl-9,10-Anthraquinone No suppilers available for the product. |
| Name | 2-Butyl-9,10-Anthraquinone |
|---|---|
| Synonyms | 2-Butyl-9,10-Anthraquinone; Nsc401174 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 |
| CAS Registry Number | 7504-51-0 |
| SMILES | C1=C(CCCC)C=CC3=C1C(=O)C2=C(C=CC=C2)C3=O |
| InChI | 1S/C18H16O2/c1-2-3-6-12-9-10-15-16(11-12)18(20)14-8-5-4-7-13(14)17(15)19/h4-5,7-11H,2-3,6H2,1H3 |
| InChIKey | MAKLMMYWGTWPQM-UHFFFAOYSA-N |
| Density | 1.175g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.062°C at 760 mmHg (Cal.) |
| Flash point | 162.772°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Butyl-9,10-Anthraquinone |