Online Database of Chemicals from Around the World
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (650) 278-9963 | |||
 |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | (2S,4R,9beta,16alpha)-2,16,20,24,25-Pentahydroxy-9,10,14-trimethyl-4,9-cyclo-9,10-secocholest-5-ene-1,11,22-trione |
|---|---|
| Synonyms | Cucurbitacin H |
| Molecular Structure |  |
| Molecular Formula | C30H46O8 |
| Molecular Weight | 534.68 |
| CAS Registry Number | 751-95-1 |
| SMILES | C[C@@]12C[C@H]([C@@H]([C@]1(CC(=O)[C@@]3([C@H]2CC=C4[C@H]3C[C@@H](C(=O)C4(C)C)O)C)C)[C@](C)(C(=O)CC(C(C)(C)O)O)O)O |
| InChI | 1S/C30H46O8/c1-25(2)15-9-10-19-27(5)13-18(32)23(30(8,38)21(34)12-20(33)26(3,4)37)28(27,6)14-22(35)29(19,7)16(15)11-17(31)24(25)36/h9,16-20,23,31-33,37-38H,10-14H2,1-8H3/t16-,17+,18-,19+,20?,23+,27+,28-,29+,30+/m1/s1 |
| InChIKey | ABNDMUIXCBUBLO-REQJDAJISA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 723.4±60.0°C at 760 mmHg (Cal.) |
| Flash point | 405.2±29.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S,4R,9beta,16alpha)-2,16,20,24,25-Pentahydroxy-9,10,14-trimethyl-4,9-cyclo-9,10-secocholest-5-ene-1,11,22-trione |