|
CAS#: 7510-34-1 Product: 1,2,3,4-Tetraphenyl-2-Butene-1,4-Dione No suppilers available for the product. |
| Name | 1,2,3,4-Tetraphenyl-2-Butene-1,4-Dione |
|---|---|
| Synonyms | 2-Butene-1,4-Dione, 1,2,3,4-Tetraphenyl-, (Z)-; (2Z)-1,2,3,4-Tetraphenyl-2-Butene-1,4-Dione; Nsc39819 |
| Molecular Structure | ![]() |
| Molecular Formula | C28H20O2 |
| Molecular Weight | 388.46 |
| CAS Registry Number | 7510-34-1 |
| SMILES | C1=C(C=CC=C1)C(C(=C(/C2=CC=CC=C2)C(=O)C3=CC=CC=C3)/C4=CC=CC=C4)=O |
| InChI | 1S/C28H20O2/c29-27(23-17-9-3-10-18-23)25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)28(30)24-19-11-4-12-20-24/h1-20H/b26-25- |
| InChIKey | BNSSPRIZPRPVAS-QPLCGJKRSA-N |
| Density | 1.173g/cm3 (Cal.) |
|---|---|
| Boiling point | 546.3°C at 760 mmHg (Cal.) |
| Flash point | 200.394°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4-Tetraphenyl-2-Butene-1,4-Dione |