Online Database of Chemicals from Around the World
| Name | Sodium 1-Oxidopyridine-2-Thione |
|---|---|
| Synonyms | Sodium 1-Oxidopyridin-1-Ium-2-Thiolate; Sodium 1-Oxido-2-Pyridin-1-Iumthiolate; Sodium 1-Oxido-2-Pyridinethione |
| Molecular Structure |  |
| Molecular Formula | C5H4NNaOS |
| Molecular Weight | 149.14 |
| CAS Registry Number | 75164-71-5 (15922-78-8) |
| SMILES | C1(N(C=CC=C1)[O-])=S.[Na+] |
| InChI | 1S/C5H4NOS.Na/c7-6-4-2-1-3-5(6)8;/h1-4H;/q-1;+1 |
| InChIKey | XNRNJIIJLOFJEK-UHFFFAOYSA-N |
| Boiling point | 253.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 107.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 1-Oxidopyridine-2-Thione |
