|
CAS#: 75195-49-2 Product: 3-Hydroxybutorphanol No suppilers available for the product. |
| Name | 3-Hydroxybutorphanol |
|---|---|
| Synonyms | Morphinan-3,14-Diol, 17-((3-Hydroxycyclobutyl)Methyl)-, (17(Trans))- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 |
| CAS Registry Number | 75195-49-2 |
| SMILES | C1=C(O)C=CC4=C1C25C(O)(C(N(CC2)CC3CC(O)C3)C4)CCCC5 |
| InChI | 1S/C21H29NO3/c23-16-4-3-15-11-19-21(25)6-2-1-5-20(21,18(15)12-16)7-8-22(19)13-14-9-17(24)10-14/h3-4,12,14,17,19,23-25H,1-2,5-11,13H2 |
| InChIKey | NCMXKIHJYUFTRL-UHFFFAOYSA-N |
| Density | 1.318g/cm3 (Cal.) |
|---|---|
| Boiling point | 550.298°C at 760 mmHg (Cal.) |
| Flash point | 301.844°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Hydroxybutorphanol |