|
CAS#: 75228-68-1 Product: 2,2-Dichloro-N-(Furan-2-Ylmethyl)-N-Methylacetamide No suppilers available for the product. |
| Name | 2,2-Dichloro-N-(Furan-2-Ylmethyl)-N-Methylacetamide |
|---|---|
| Synonyms | 2,2-Dichloro-N-(2-Furylmethyl)-N-Methyl-Acetamide; 2,2-Dichloro-N-(2-Furylmethyl)-N-Methylacetamide; 2,2-Dichloro-N-(Furan-2-Ylmethyl)-N-Methyl-Ethanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9Cl2NO2 |
| Molecular Weight | 222.07 |
| CAS Registry Number | 75228-68-1 |
| SMILES | C1=C(CN(C(C(Cl)Cl)=O)C)OC=C1 |
| InChI | 1S/C8H9Cl2NO2/c1-11(8(12)7(9)10)5-6-3-2-4-13-6/h2-4,7H,5H2,1H3 |
| InChIKey | HZCMBZFCDUGLLC-UHFFFAOYSA-N |
| Density | 1.341g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.7°C at 760 mmHg (Cal.) |
| Flash point | 133.24°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dichloro-N-(Furan-2-Ylmethyl)-N-Methylacetamide |