|
CAS#: 7528-00-9 Product: Dextroamphetamine Phosphate No suppilers available for the product. |
| Name | Dextroamphetamine Phosphate |
|---|---|
| Synonyms | (1-Methyl-2-Phenyl-Ethyl)Amine; Phosphoric Acid; (1)-Alpha-Methylphenethylammonium Dihydrogen Phosphate; 1-Phenyl-2-Aminopropane Monophosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H16NO4P |
| Molecular Weight | 233.20 |
| CAS Registry Number | 7528-00-9 |
| SMILES | O=[P](O)(O)O.C1=C(CC(N)C)C=CC=C1 |
| InChI | 1S/C9H13N.H3O4P/c1-8(10)7-9-5-3-2-4-6-9;1-5(2,3)4/h2-6,8H,7,10H2,1H3;(H3,1,2,3,4) |
| InChIKey | ZHVLGOLHHYJSBZ-UHFFFAOYSA-N |
| Boiling point | 201.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 87.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dextroamphetamine Phosphate |